C15H20N2O2S — CID 25040448
N-[(2R)-3,3-dimethylbutan-2-yl]isoquinoline-5-sulfonamide (PubChem CID 25040448) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]isoquinoline-5-sulfonamide.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 25040448 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]isoquinoline-5-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2cnccc12)C(C)(C)C |
| InChI | InChI=1S/C15H20N2O2S/c1-11(15(2,3)4)17-20(18,19)14-7-5-6-12-10-16-9-8-13(12)14/h5-11,17H,1-4H3/t11-/m1/s1 |
| InChIKey | SXCQQFQOFSTDFX-LLVKDONJSA-N |
| XLogP | 2.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |