C16H21N3O4S — CID 175382534
[2-(isoquinolin-5-ylsulfonylamino)-3,3-dimethylbutyl] carbamate (PubChem CID 175382534) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is [2-(isoquinolin-5-ylsulfonylamino)-3,3-dimethylbutyl] carbamate.
| Compound Name | [2-(isoquinolin-5-ylsulfonylamino)-3,3-dimethylbutyl] carbamate |
|---|---|
| PubChem CID | 175382534 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [2-(isoquinolin-5-ylsulfonylamino)-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)C(COC(N)=O)NS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C16H21N3O4S/c1-16(2,3)14(10-23-15(17)20)19-24(21,22)13-6-4-5-11-9-18-8-7-12(11)13/h4-9,14,19H,10H2,1-3H3,(H2,17,20) |
| InChIKey | KESBVCQVPXGDLD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |