C12H12N2O4S — CID 54991574
(2R)-2-(isoquinolin-5-ylsulfonylamino)propanoic acid (PubChem CID 54991574) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is (2R)-2-(isoquinolin-5-ylsulfonylamino)propanoic acid.
| Compound Name | (2R)-2-(isoquinolin-5-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 54991574 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (2R)-2-(isoquinolin-5-ylsulfonylamino)propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2cnccc12)C(=O)O |
| InChI | InChI=1S/C12H12N2O4S/c1-8(12(15)16)14-19(17,18)11-4-2-3-9-7-13-6-5-10(9)11/h2-8,14H,1H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | XJKBZYMJSOKACE-MRVPVSSYSA-N |
| XLogP | 0.99 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |