C14H23N2O2S+ — CID 123201963
methyl-methylidene-[2-methyl-1-[(2-methylphenyl)sulfonylamino]butan-2-yl]azanium (PubChem CID 123201963) has the molecular formula C14H23N2O2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is methyl-methylidene-[2-methyl-1-[(2-methylphenyl)sulfonylamino]butan-2-yl]azanium.
| Compound Name | methyl-methylidene-[2-methyl-1-[(2-methylphenyl)sulfonylamino]butan-2-yl]azanium |
|---|---|
| PubChem CID | 123201963 |
| Molecular Formula | C14H23N2O2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl-methylidene-[2-methyl-1-[(2-methylphenyl)sulfonylamino]butan-2-yl]azanium |
| SMILES | C=[N+](C)C(C)(CC)CNS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C14H23N2O2S/c1-6-14(3,16(4)5)11-15-19(17,18)13-10-8-7-9-12(13)2/h7-10,15H,4,6,11H2,1-3,5H3/q+1 |
| InChIKey | BPXQMXDTEXBPSG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|