C17H21NO3S2 — CID 90497099
N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-1-(3-methylphenyl)methanesulfonamide (PubChem CID 90497099) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 90497099 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxy-2-thiophen-2-ylethyl)-1-(3-methylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NCC(O)(c2cccs2)C2CC2)c1 |
| InChI | InChI=1S/C17H21NO3S2/c1-13-4-2-5-14(10-13)11-23(20,21)18-12-17(19,15-7-8-15)16-6-3-9-22-16/h2-6,9-10,15,18-19H,7-8,11-12H2,1H3 |
| InChIKey | SOVRQVRQAQTVTM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |