C18H23NO5S — CID 121085545
N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-5-ethyl-2-methoxybenzenesulfonamide (PubChem CID 121085545) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-5-ethyl-2-methoxybenzenesulfonamide.
| Compound Name | N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-5-ethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121085545 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-5-ethyl-2-methoxybenzenesulfonamide |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)NCC(O)(c2ccco2)C2CC2)c1 |
| InChI | InChI=1S/C18H23NO5S/c1-3-13-6-9-15(23-2)16(11-13)25(21,22)19-12-18(20,14-7-8-14)17-5-4-10-24-17/h4-6,9-11,14,19-20H,3,7-8,12H2,1-2H3 |
| InChIKey | YTZHYBZXZQTESK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |