C19H19NO5 — CID 95982356
N-[(2S)-2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 95982356) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is N-[(2S)-2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 95982356 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-[(2S)-2-cyclopropyl-2-(furan-2-yl)-2-hydroxyethyl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NC[C@](O)(c3ccco3)C3CC3)oc12 |
| InChI | InChI=1S/C19H19NO5/c1-23-14-5-2-4-12-10-15(25-17(12)14)18(21)20-11-19(22,13-7-8-13)16-6-3-9-24-16/h2-6,9-10,13,22H,7-8,11H2,1H3,(H,20,21)/t19-/m1/s1 |
| InChIKey | BWCJRFHPQGDDJE-LJQANCHMSA-N |
| XLogP | 3.06 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |