C17H21NO4S — CID 86265197
7-methoxy-N-[2-(oxan-4-ylsulfanyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 86265197) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is 7-methoxy-N-[2-(oxan-4-ylsulfanyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-methoxy-N-[2-(oxan-4-ylsulfanyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 86265197 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 7-methoxy-N-[2-(oxan-4-ylsulfanyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCCSC3CCOCC3)oc12 |
| InChI | InChI=1S/C17H21NO4S/c1-20-14-4-2-3-12-11-15(22-16(12)14)17(19)18-7-10-23-13-5-8-21-9-6-13/h2-4,11,13H,5-10H2,1H3,(H,18,19) |
| InChIKey | HXCYGSAJTLGDDD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|