C20H20FNO4 — CID 97428375
N-[(2S)-2-(2-fluorophenyl)-2-methoxypropyl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 97428375) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[(2S)-2-(2-fluorophenyl)-2-methoxypropyl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-2-(2-fluorophenyl)-2-methoxypropyl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 97428375 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[(2S)-2-(2-fluorophenyl)-2-methoxypropyl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NC[C@@](C)(OC)c3ccccc3F)oc12 |
| InChI | InChI=1S/C20H20FNO4/c1-20(25-3,14-8-4-5-9-15(14)21)12-22-19(23)17-11-13-7-6-10-16(24-2)18(13)26-17/h4-11H,12H2,1-3H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | QRAMWVGJTSGJPK-HXUWFJFHSA-N |
| XLogP | 3.87 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |