C20H18FNO4 — CID 90599147
N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-oxochromene-2-carboxamide (PubChem CID 90599147) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 90599147 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-methoxypropyl]-4-oxochromene-2-carboxamide |
| SMILES | COC(C)(CNC(=O)c1cc(=O)c2ccccc2o1)c1ccccc1F |
| InChI | InChI=1S/C20H18FNO4/c1-20(25-2,14-8-4-5-9-15(14)21)12-22-19(24)18-11-16(23)13-7-3-6-10-17(13)26-18/h3-11H,12H2,1-2H3,(H,22,24) |
| InChIKey | BYSHMQGVFAGNEE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |