C16H21NO4S2 — CID 90500244
4-ethoxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylbenzenesulfonamide (PubChem CID 90500244) has the molecular formula C16H21NO4S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-ethoxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylbenzenesulfonamide.
| Compound Name | 4-ethoxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90500244 |
| Molecular Formula | C16H21NO4S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-ethoxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCC(C)(O)c2cccs2)cc1C |
| InChI | InChI=1S/C16H21NO4S2/c1-4-21-14-8-7-13(10-12(14)2)23(19,20)17-11-16(3,18)15-6-5-9-22-15/h5-10,17-18H,4,11H2,1-3H3 |
| InChIKey | ZOPIHDCWPKPQKG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |