C19H21NO4S3 — CID 121170232
2-ethoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-5-methylbenzenesulfonamide (PubChem CID 121170232) has the molecular formula C19H21NO4S3 and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-ethoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-5-methylbenzenesulfonamide.
| Compound Name | 2-ethoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 121170232 |
| Molecular Formula | C19H21NO4S3 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-ethoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-5-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(C)cc1S(=O)(=O)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C19H21NO4S3/c1-3-24-16-7-6-14(2)11-17(16)27(22,23)20-13-19(21,15-8-10-25-12-15)18-5-4-9-26-18/h4-12,20-21H,3,13H2,1-2H3 |
| InChIKey | OGPRQKWQLXNLPC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |