C17H14N2O3S3 — CID 129417818
4-cyano-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzenesulfonamide (PubChem CID 129417818) has the molecular formula C17H14N2O3S3 and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-cyano-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129417818 |
| Molecular Formula | C17H14N2O3S3 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 4-cyano-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC[C@@](O)(c2ccsc2)c2cccs2)cc1 |
| InChI | InChI=1S/C17H14N2O3S3/c18-10-13-3-5-15(6-4-13)25(21,22)19-12-17(20,14-7-9-23-11-14)16-2-1-8-24-16/h1-9,11,19-20H,12H2/t17-/m1/s1 |
| InChIKey | SSZBCTMDNXQTPN-QGZVFWFLSA-N |
| XLogP | 2.90 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |