C17H16N2O5S3 — CID 121170237
N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 121170237) has the molecular formula C17H16N2O5S3 and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121170237 |
| Molecular Formula | C17H16N2O5S3 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C17H16N2O5S3/c1-12-4-5-14(19(21)22)9-15(12)27(23,24)18-11-17(20,13-6-8-25-10-13)16-3-2-7-26-16/h2-10,18,20H,11H2,1H3 |
| InChIKey | YWPQBARFCXAPLL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|