C16H14N2O5S3 — CID 121170212
N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-nitrobenzenesulfonamide (PubChem CID 121170212) has the molecular formula C16H14N2O5S3 and a molecular weight of 410.50 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121170212 |
| Molecular Formula | C16H14N2O5S3 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C16H14N2O5S3/c19-16(12-7-9-24-10-12,15-6-3-8-25-15)11-17-26(22,23)14-5-2-1-4-13(14)18(20)21/h1-10,17,19H,11H2 |
| InChIKey | OTKDPZNEFDVTTP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|