C18H17NO4S3 — CID 121170202
4-acetyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 121170202) has the molecular formula C18H17NO4S3 and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-acetyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121170202 |
| Molecular Formula | C18H17NO4S3 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 4-acetyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC(O)(c2ccsc2)c2cccs2)cc1 |
| InChI | InChI=1S/C18H17NO4S3/c1-13(20)14-4-6-16(7-5-14)26(22,23)19-12-18(21,15-8-10-24-11-15)17-3-2-9-25-17/h2-11,19,21H,12H2,1H3 |
| InChIKey | YMFUCVWUNLIVKZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |