C17H17NO4S3 — CID 124878125
N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]-3-methoxybenzenesulfonamide (PubChem CID 124878125) has the molecular formula C17H17NO4S3 and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]-3-methoxybenzenesulfonamide.
| Compound Name | N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 124878125 |
| Molecular Formula | C17H17NO4S3 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]-3-methoxybenzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)NC[C@@](O)(c2ccsc2)c2cccs2)c1 |
| InChI | InChI=1S/C17H17NO4S3/c1-22-14-4-2-5-15(10-14)25(20,21)18-12-17(19,13-7-9-23-11-13)16-6-3-8-24-16/h2-11,18-19H,12H2,1H3/t17-/m1/s1 |
| InChIKey | WTJBUEBHFZTHKS-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |