C19H21NO3S3 — CID 121170206
N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-4-propan-2-ylbenzenesulfonamide (PubChem CID 121170206) has the molecular formula C19H21NO3S3 and a molecular weight of 407.58 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 121170206 |
| Molecular Formula | C19H21NO3S3 |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NCC(O)(c2ccsc2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H21NO3S3/c1-14(2)15-5-7-17(8-6-15)26(22,23)20-13-19(21,16-9-11-24-12-16)18-4-3-10-25-18/h3-12,14,20-21H,13H2,1-2H3 |
| InChIKey | ALNMQERPBPHMCJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |