C17H16FNO3S3 — CID 121170190
1-(3-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)methanesulfonamide (PubChem CID 121170190) has the molecular formula C17H16FNO3S3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 121170190 |
| Molecular Formula | C17H16FNO3S3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(F)c1)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C17H16FNO3S3/c18-15-4-1-3-13(9-15)11-25(21,22)19-12-17(20,14-6-8-23-10-14)16-5-2-7-24-16/h1-10,19-20H,11-12H2 |
| InChIKey | IXOBKBOKFMEFPM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |