C19H18N2O3S2 — CID 121170286
N-benzyl-N'-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 121170286) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-benzyl-N'-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N-benzyl-N'-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 121170286 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-benzyl-N'-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C19H18N2O3S2/c22-17(20-11-14-5-2-1-3-6-14)18(23)21-13-19(24,15-8-10-25-12-15)16-7-4-9-26-16/h1-10,12,24H,11,13H2,(H,20,22)(H,21,23) |
| InChIKey | OOGUKPVKXAKNJV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|