C19H19NO2S3 — CID 124760669
2-benzylsulfanyl-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]acetamide (PubChem CID 124760669) has the molecular formula C19H19NO2S3 and a molecular weight of 389.57 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 124760669 |
| Molecular Formula | C19H19NO2S3 |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-benzylsulfanyl-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]acetamide |
| SMILES | O=C(CSCc1ccccc1)NC[C@@](O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C19H19NO2S3/c21-18(13-24-11-15-5-2-1-3-6-15)20-14-19(22,16-8-10-23-12-16)17-7-4-9-25-17/h1-10,12,22H,11,13-14H2,(H,20,21)/t19-/m1/s1 |
| InChIKey | OTRNNIGTXDTGEG-LJQANCHMSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |