C19H19NO3S2 — CID 121018436
N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylmethoxyacetamide (PubChem CID 121018436) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylmethoxyacetamide.
| Compound Name | N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 121018436 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylmethoxyacetamide |
| SMILES | O=C(COCc1ccccc1)NCC(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C19H19NO3S2/c21-18(13-23-12-15-6-2-1-3-7-15)20-14-19(22,16-8-4-10-24-16)17-9-5-11-25-17/h1-11,22H,12-14H2,(H,20,21) |
| InChIKey | YJDMKNIFQGCBKU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |