C20H21NO2S2 — CID 119099245
N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylbutanamide (PubChem CID 119099245) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylbutanamide.
| Compound Name | N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 119099245 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-(2-hydroxy-2,2-dithiophen-2-ylethyl)-2-phenylbutanamide |
| SMILES | CCC(C(=O)NCC(O)(c1cccs1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2S2/c1-2-16(15-8-4-3-5-9-15)19(22)21-14-20(23,17-10-6-12-24-17)18-11-7-13-25-18/h3-13,16,23H,2,14H2,1H3,(H,21,22) |
| InChIKey | IGTAVTGBUJOCBW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |