C13H17NO4 — CID 43239307
4-[(2-phenylmethoxyacetyl)amino]butanoic acid (PubChem CID 43239307) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-[(2-phenylmethoxyacetyl)amino]butanoic acid.
| Compound Name | 4-[(2-phenylmethoxyacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43239307 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(2-phenylmethoxyacetyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c15-12(14-8-4-7-13(16)17)10-18-9-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,14,15)(H,16,17) |
| InChIKey | YEWXZOGPRVPYEP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|