C19H25NO2S2 — CID 121170042
3-cyclohexyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)propanamide (PubChem CID 121170042) has the molecular formula C19H25NO2S2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 3-cyclohexyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)propanamide.
| Compound Name | 3-cyclohexyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 121170042 |
| Molecular Formula | C19H25NO2S2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-cyclohexyl-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)propanamide |
| SMILES | O=C(CCC1CCCCC1)NCC(O)(c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C19H25NO2S2/c21-18(9-8-15-5-2-1-3-6-15)20-14-19(22,16-10-12-23-13-16)17-7-4-11-24-17/h4,7,10-13,15,22H,1-3,5-6,8-9,14H2,(H,20,21) |
| InChIKey | OAICRHJMVPNZLN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |