C21H25NO2S2 — CID 121170078
N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)adamantane-1-carboxamide (PubChem CID 121170078) has the molecular formula C21H25NO2S2 and a molecular weight of 387.57 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)adamantane-1-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 121170078 |
| Molecular Formula | C21H25NO2S2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCC(O)(c1ccsc1)c1cccs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H25NO2S2/c23-19(20-9-14-6-15(10-20)8-16(7-14)11-20)22-13-21(24,17-3-5-25-12-17)18-2-1-4-26-18/h1-5,12,14-16,24H,6-11,13H2,(H,22,23) |
| InChIKey | RHAGSLNMRLJRJX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |