C17H13ClFNO2S2 — CID 124759513
2-chloro-6-fluoro-N-[(2R)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzamide (PubChem CID 124759513) has the molecular formula C17H13ClFNO2S2 and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[(2R)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[(2R)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzamide |
|---|---|
| PubChem CID | 124759513 |
| Molecular Formula | C17H13ClFNO2S2 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2-chloro-6-fluoro-N-[(2R)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]benzamide |
| SMILES | O=C(NC[C@](O)(c1ccsc1)c1cccs1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H13ClFNO2S2/c18-12-3-1-4-13(19)15(12)16(21)20-10-17(22,11-6-8-23-9-11)14-5-2-7-24-14/h1-9,22H,10H2,(H,20,21)/t17-/m0/s1 |
| InChIKey | GBYYXDLNVHAMCG-KRWDZBQOSA-N |
| XLogP | 4.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |