C21H23NO3S2 — CID 121170103
4-butoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzamide (PubChem CID 121170103) has the molecular formula C21H23NO3S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-butoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzamide.
| Compound Name | 4-butoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 121170103 |
| Molecular Formula | C21H23NO3S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-butoxy-N-(2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(O)(c2ccsc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H23NO3S2/c1-2-3-11-25-18-8-6-16(7-9-18)20(23)22-15-21(24,17-10-13-26-14-17)19-5-4-12-27-19/h4-10,12-14,24H,2-3,11,15H2,1H3,(H,22,23) |
| InChIKey | HKGZQRCDJKBGOJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|