C17H23NO3S — CID 111440651
1-[(3-ethoxy-4-methoxyphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol (PubChem CID 111440651) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(3-ethoxy-4-methoxyphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol.
| Compound Name | 1-[(3-ethoxy-4-methoxyphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 111440651 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[(3-ethoxy-4-methoxyphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
| SMILES | CCOc1cc(CNCC(C)(O)c2cccs2)ccc1OC |
| InChI | InChI=1S/C17H23NO3S/c1-4-21-15-10-13(7-8-14(15)20-3)11-18-12-17(2,19)16-6-5-9-22-16/h5-10,18-19H,4,11-12H2,1-3H3 |
| InChIKey | VMYGZFCEORHHTH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |