C15H16N2OS — CID 111440639
4-[[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methyl]benzonitrile (PubChem CID 111440639) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-[[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 111440639 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-[[(2-hydroxy-2-thiophen-2-ylpropyl)amino]methyl]benzonitrile |
| SMILES | CC(O)(CNCc1ccc(C#N)cc1)c1cccs1 |
| InChI | InChI=1S/C15H16N2OS/c1-15(18,14-3-2-8-19-14)11-17-10-13-6-4-12(9-16)5-7-13/h2-8,17-18H,10-11H2,1H3 |
| InChIKey | RZAVKUMJSGGXGS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |