C18H24N2O2S — CID 111440525
1-[(4-morpholin-4-ylphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol (PubChem CID 111440525) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[(4-morpholin-4-ylphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol.
| Compound Name | 1-[(4-morpholin-4-ylphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 111440525 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-[(4-morpholin-4-ylphenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
| SMILES | CC(O)(CNCc1ccc(N2CCOCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C18H24N2O2S/c1-18(21,17-3-2-12-23-17)14-19-13-15-4-6-16(7-5-15)20-8-10-22-11-9-20/h2-7,12,19,21H,8-11,13-14H2,1H3 |
| InChIKey | PEZSEDYMHRKAPP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|