C15H23N3O4S — CID 90499911
N'-(2-hydroxy-2-thiophen-2-ylpropyl)-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 90499911) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is N'-(2-hydroxy-2-thiophen-2-ylpropyl)-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 90499911 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N'-(2-hydroxy-2-thiophen-2-ylpropyl)-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)NCCN1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C15H23N3O4S/c1-15(21,12-3-2-10-23-12)11-17-14(20)13(19)16-4-5-18-6-8-22-9-7-18/h2-3,10,21H,4-9,11H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | OQDPJKKFCFHYAQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|