C14H20N2O4S — CID 95983382
N'-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide (PubChem CID 95983382) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N'-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide.
| Compound Name | N'-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 95983382 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N'-[(2S)-2-hydroxy-2-thiophen-2-ylpropyl]-N-[[(2R)-oxolan-2-yl]methyl]oxamide |
| SMILES | C[C@](O)(CNC(=O)C(=O)NC[C@H]1CCCO1)c1cccs1 |
| InChI | InChI=1S/C14H20N2O4S/c1-14(19,11-5-3-7-21-11)9-16-13(18)12(17)15-8-10-4-2-6-20-10/h3,5,7,10,19H,2,4,6,8-9H2,1H3,(H,15,17)(H,16,18)/t10-,14+/m1/s1 |
| InChIKey | WZEZXATZZHFWJL-YGRLFVJLSA-N |
| XLogP | 0.37 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|