C18H25N3O6 — CID 90497880
N'-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 90497880) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 90497880 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | CC(O)(CNC(=O)C(=O)NCCN1CCOCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H25N3O6/c1-18(24,13-2-3-14-15(10-13)27-12-26-14)11-20-17(23)16(22)19-4-5-21-6-8-25-9-7-21/h2-3,10,24H,4-9,11-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | AKNMSLHLFMJEHN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|