C18H22N2O4 — CID 101018068
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-ylethyl)penta-2,4-dienamide (PubChem CID 101018068) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-ylethyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-ylethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 101018068 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-ylethyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)NCCN1CCOCC1 |
| InChI | InChI=1S/C18H22N2O4/c21-18(19-7-8-20-9-11-22-12-10-20)4-2-1-3-15-5-6-16-17(13-15)24-14-23-16/h1-6,13H,7-12,14H2,(H,19,21)/b3-1+,4-2+ |
| InChIKey | DYUMOYZMKWECDY-ZPUQHVIOSA-N |
| XLogP | 1.43 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|