C26H27NO6 — CID 123241646
1-(1,3-benzodioxol-5-yl)-7-[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 123241646) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-7-[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-7-[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123241646 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-7-[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1ccc(OCCN2CCOCC2)cc1)CC(=O)C=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H27NO6/c28-22(18-23(29)7-2-21-5-10-25-26(17-21)33-19-32-25)6-1-20-3-8-24(9-4-20)31-16-13-27-11-14-30-15-12-27/h1-10,17H,11-16,18-19H2 |
| InChIKey | KQQATWMGKBRCJF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|