C20H25N3O3 — CID 19567216
(E)-1-(2,5-dimethylpyrazol-3-yl)-3-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-en-1-one (PubChem CID 19567216) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylpyrazol-3-yl)-3-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylpyrazol-3-yl)-3-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19567216 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (E)-1-(2,5-dimethylpyrazol-3-yl)-3-[4-(2-morpholin-4-ylethoxy)phenyl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(OCCN3CCOCC3)cc2)n(C)n1 |
| InChI | InChI=1S/C20H25N3O3/c1-16-15-19(22(2)21-16)20(24)8-5-17-3-6-18(7-4-17)26-14-11-23-9-12-25-13-10-23/h3-8,15H,9-14H2,1-2H3/b8-5+ |
| InChIKey | YLZZFZVXTBNONB-VMPITWQZSA-N |
| XLogP | 2.34 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|