C25H28N2O4 — CID 19567180
(E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one (PubChem CID 19567180) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19567180 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-(2,5-dimethylpyrazol-3-yl)prop-2-en-1-one |
| SMILES | CCOc1ccc(COc2ccc(/C=C/C(=O)c3cc(C)nn3C)cc2)cc1OCC |
| InChI | InChI=1S/C25H28N2O4/c1-5-29-24-14-10-20(16-25(24)30-6-2)17-31-21-11-7-19(8-12-21)9-13-23(28)22-15-18(3)26-27(22)4/h7-16H,5-6,17H2,1-4H3/b13-9+ |
| InChIKey | ZGJLVRYMSDKOQK-UKTHLTGXSA-N |
| XLogP | 5.00 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|