C28H28F2O6 — CID 19550848
(E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 19550848) has the molecular formula C28H28F2O6 and a molecular weight of 498.52 g/mol. Its IUPAC name is (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19550848 |
| Molecular Formula | C28H28F2O6 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (E)-3-[4-[(3,4-diethoxyphenyl)methoxy]phenyl]-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCOc1ccc(COc2ccc(/C=C/C(=O)c3ccc(OC(F)F)c(OC)c3)cc2)cc1OCC |
| InChI | InChI=1S/C28H28F2O6/c1-4-33-24-14-9-20(16-27(24)34-5-2)18-35-22-11-6-19(7-12-22)8-13-23(31)21-10-15-25(36-28(29)30)26(17-21)32-3/h6-17,28H,4-5,18H2,1-3H3/b13-8+ |
| InChIKey | ZWDRRZBPNBIRMR-MDWZMJQESA-N |
| XLogP | 6.57 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|