C25H27N3O4 — CID 19567233
2-[4-[(E)-3-(2,5-dimethylpyrazol-3-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 19567233) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2,5-dimethylpyrazol-3-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[(E)-3-(2,5-dimethylpyrazol-3-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19567233 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[4-[(E)-3-(2,5-dimethylpyrazol-3-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2cc(C)nn2C)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C25H27N3O4/c1-5-31-24-15-19(8-12-22(29)21-14-18(3)27-28(21)4)9-13-23(24)32-16-25(30)26-20-10-6-17(2)7-11-20/h6-15H,5,16H2,1-4H3,(H,26,30)/b12-8+ |
| InChIKey | XLBJUFBLMBCQJA-XYOKQWHBSA-N |
| XLogP | 4.35 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|