C24H25N3O4 — CID 19556620
2-[4-[(E)-3-(1,3-dimethylpyrazol-4-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 19556620) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[4-[(E)-3-(1,3-dimethylpyrazol-4-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(E)-3-(1,3-dimethylpyrazol-4-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 19556620 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 2-[4-[(E)-3-(1,3-dimethylpyrazol-4-yl)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2cn(C)nc2C)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H25N3O4/c1-4-30-23-14-18(10-12-21(28)20-15-27(3)26-17(20)2)11-13-22(23)31-16-24(29)25-19-8-6-5-7-9-19/h5-15H,4,16H2,1-3H3,(H,25,29)/b12-10+ |
| InChIKey | XZILZGASEYQJAH-ZRDIBKRKSA-N |
| XLogP | 4.04 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|