C25H27N3O4 — CID 19563503
2-[2-ethoxy-4-[(E)-3-(1-ethylpyrazol-3-yl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 19563503) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-3-(1-ethylpyrazol-3-yl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-3-(1-ethylpyrazol-3-yl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19563503 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-3-(1-ethylpyrazol-3-yl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccn(CC)n2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C25H27N3O4/c1-4-28-15-14-21(27-28)22(29)12-10-19-11-13-23(24(16-19)31-5-2)32-17-25(30)26-20-9-7-6-8-18(20)3/h6-16H,4-5,17H2,1-3H3,(H,26,30)/b12-10+ |
| InChIKey | BCWUDFFJKXRWQF-ZRDIBKRKSA-N |
| XLogP | 4.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|