C26H25NO5 — CID 19562910
2-[2-ethoxy-4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 19562910) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19562910 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-3-(3-hydroxyphenyl)-3-oxoprop-1-enyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C/C(=O)c2cccc(O)c2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H25NO5/c1-3-31-25-15-19(11-13-23(29)20-8-6-9-21(28)16-20)12-14-24(25)32-17-26(30)27-22-10-5-4-7-18(22)2/h4-16,28H,3,17H2,1-2H3,(H,27,30)/b13-11+ |
| InChIKey | RYTSGEGBNQRSJO-ACCUITESSA-N |
| XLogP | 5.01 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|