C31H38N2O6 — CID 123906714
1,7-bis[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 123906714) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is 1,7-bis[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 123906714 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 1,7-bis[4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | O=C(C=Cc1ccc(OCCN2CCOCC2)cc1)CC(=O)C=Cc1ccc(OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H38N2O6/c34-28(7-1-26-3-9-30(10-4-26)38-23-17-32-13-19-36-20-14-32)25-29(35)8-2-27-5-11-31(12-6-27)39-24-18-33-15-21-37-22-16-33/h1-12H,13-25H2 |
| InChIKey | QUYJPXQKEGNDSN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|