C28H31NO7 — CID 118305337
(1E,6E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 118305337) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is (1E,6E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 118305337 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (1E,6E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(OCCN2CCOCC2)ccc1/C=C/C(=O)CC(=O)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C28H31NO7/c1-32-27-20-25(34-15-12-29-10-13-33-14-11-29)8-5-22(27)4-7-24(31)19-23(30)6-2-21-3-9-26-28(18-21)36-17-16-35-26/h2-9,18,20H,10-17,19H2,1H3/b6-2+,7-4+ |
| InChIKey | OWOPWCLBMJZRFJ-DDEVBNQJSA-N |
| XLogP | 3.43 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|