C28H30N2O5 — CID 142718885
1-(1H-indol-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 142718885) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | 1-(1H-indol-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 142718885 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-(1H-indol-6-yl)-7-[2-methoxy-4-(2-morpholin-4-ylethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(OCCN2CCOCC2)ccc1C=CC(=O)CC(=O)C=Cc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C28H30N2O5/c1-33-28-20-26(35-17-14-30-12-15-34-16-13-30)9-6-23(28)5-8-25(32)19-24(31)7-3-21-2-4-22-10-11-29-27(22)18-21/h2-11,18,20,29H,12-17,19H2,1H3 |
| InChIKey | ASKGCWFUKUQIJL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|