C29H32N2O3 — CID 126635765
(1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 126635765) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 126635765 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (1E,6E)-1-(1H-indol-6-yl)-7-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(CN2CCC(C)CC2)ccc1/C=C/C(=O)CC(=O)/C=C/c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C29H32N2O3/c1-21-12-15-31(16-13-21)20-23-4-7-25(29(18-23)34-2)8-10-27(33)19-26(32)9-5-22-3-6-24-11-14-30-28(24)17-22/h3-11,14,17-18,21,30H,12-13,15-16,19-20H2,1-2H3/b9-5+,10-8+ |
| InChIKey | WOUNMQBEOFXQPY-MUDDOMJDSA-N |
| XLogP | 5.66 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|