C22H24Cl2N2O — CID 108760689
(E)-3-(3,4-dichlorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-enamide (PubChem CID 108760689) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108760689 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[4-[(4-methylpiperidin-1-yl)methyl]phenyl]prop-2-enamide |
| SMILES | CC1CCN(Cc2ccc(NC(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24Cl2N2O/c1-16-10-12-26(13-11-16)15-18-2-6-19(7-3-18)25-22(27)9-5-17-4-8-20(23)21(24)14-17/h2-9,14,16H,10-13,15H2,1H3,(H,25,27)/b9-5+ |
| InChIKey | GPYMLXFFQGJQRD-WEVVVXLNSA-N |
| XLogP | 5.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|