C20H21BrN2O — CID 68817727
N-(4-bromophenyl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 68817727) has the molecular formula C20H21BrN2O and a molecular weight of 385.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | N-(4-bromophenyl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68817727 |
| Molecular Formula | C20H21BrN2O |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(4-bromophenyl)-3-[4-(pyrrolidin-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(CN2CCCC2)cc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H21BrN2O/c21-18-8-10-19(11-9-18)22-20(24)12-7-16-3-5-17(6-4-16)15-23-13-1-2-14-23/h3-12H,1-2,13-15H2,(H,22,24) |
| InChIKey | OYSLKXIOXOIKPI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|