C29H32N2O — CID 18472227
(E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(piperidin-1-ylmethyl)phenyl]prop-2-enamide (PubChem CID 18472227) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(piperidin-1-ylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(piperidin-1-ylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18472227 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (E)-3-[3-(2,5-dimethylphenyl)phenyl]-N-[4-(piperidin-1-ylmethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(C)c(-c2cccc(/C=C/C(=O)Nc3ccc(CN4CCCCC4)cc3)c2)c1 |
| InChI | InChI=1S/C29H32N2O/c1-22-9-10-23(2)28(19-22)26-8-6-7-24(20-26)13-16-29(32)30-27-14-11-25(12-15-27)21-31-17-4-3-5-18-31/h6-16,19-20H,3-5,17-18,21H2,1-2H3,(H,30,32)/b16-13+ |
| InChIKey | QDLAYEUQWCZTLR-DTQAZKPQSA-N |
| XLogP | 6.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|